C13H8ClN2O4S2- — CID 7008028
3-[(5-chlorothiophen-2-yl)sulfonylamino]-1H-indole-2-carboxylate (PubChem CID 7008028) has the molecular formula C13H8ClN2O4S2- and a molecular weight of 355.80 g/mol. Its IUPAC name is 3-[(5-chlorothiophen-2-yl)sulfonylamino]-1H-indole-2-carboxylate.
| Compound Name | 3-[(5-chlorothiophen-2-yl)sulfonylamino]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 7008028 |
| Molecular Formula | C13H8ClN2O4S2- |
| Molecular Weight | 355.80 g/mol |
| Exact Mass | 354.96 |
| IUPAC Name | 3-[(5-chlorothiophen-2-yl)sulfonylamino]-1H-indole-2-carboxylate |
| SMILES | O=C([O-])c1[nH]c2ccccc2c1NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H9ClN2O4S2/c14-9-5-6-10(21-9)22(19,20)16-11-7-3-1-2-4-8(7)15-12(11)13(17)18/h1-6,15-16H,(H,17,18)/p-1 |
| InChIKey | VSNWPOFAUWDLFG-UHFFFAOYSA-M |
| XLogP | 2.05 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.80 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |