C17H13N2O6S- — CID 7006411
3-[(2-methoxycarbonylphenyl)sulfonylamino]-1H-indole-2-carboxylate (PubChem CID 7006411) has the molecular formula C17H13N2O6S- and a molecular weight of 373.37 g/mol. Its IUPAC name is 3-[(2-methoxycarbonylphenyl)sulfonylamino]-1H-indole-2-carboxylate.
| Compound Name | 3-[(2-methoxycarbonylphenyl)sulfonylamino]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 7006411 |
| Molecular Formula | C17H13N2O6S- |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 3-[(2-methoxycarbonylphenyl)sulfonylamino]-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)Nc1c(C(=O)[O-])[nH]c2ccccc12 |
| InChI | InChI=1S/C17H14N2O6S/c1-25-17(22)11-7-3-5-9-13(11)26(23,24)19-14-10-6-2-4-8-12(10)18-15(14)16(20)21/h2-9,18-19H,1H3,(H,20,21)/p-1 |
| InChIKey | MAJUHFLTKGEEQH-UHFFFAOYSA-M |
| XLogP | 1.12 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |