C23H21N5O4S — CID 91454028
3-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]-1H-indole-2-carboxylic acid (PubChem CID 91454028) has the molecular formula C23H21N5O4S and a molecular weight of 463.52 g/mol. Its IUPAC name is 3-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]-1H-indole-2-carboxylic acid.
| Compound Name | 3-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 91454028 |
| Molecular Formula | C23H21N5O4S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 3-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]-1H-indole-2-carboxylic acid |
| SMILES | CN(C)c1ccc(/N=N/c2ccc(S(=O)(=O)Nc3c(C(=O)O)[nH]c4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C23H21N5O4S/c1-28(2)17-11-7-15(8-12-17)25-26-16-9-13-18(14-10-16)33(31,32)27-21-19-5-3-4-6-20(19)24-22(21)23(29)30/h3-14,24,27H,1-2H3,(H,29,30)/b26-25+ |
| InChIKey | MKQNKHYMJQIRQH-OCEACIFDSA-N |
| XLogP | 5.15 |
| TPSA | 127.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|