C9H6ClNO4S3 — CID 43443028
3-[(5-chlorothiophen-2-yl)sulfonylamino]thiophene-2-carboxylic acid (PubChem CID 43443028) has the molecular formula C9H6ClNO4S3 and a molecular weight of 323.80 g/mol. Its IUPAC name is 3-[(5-chlorothiophen-2-yl)sulfonylamino]thiophene-2-carboxylic acid.
| Compound Name | 3-[(5-chlorothiophen-2-yl)sulfonylamino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 43443028 |
| Molecular Formula | C9H6ClNO4S3 |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 322.91 |
| IUPAC Name | 3-[(5-chlorothiophen-2-yl)sulfonylamino]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C9H6ClNO4S3/c10-6-1-2-7(17-6)18(14,15)11-5-3-4-16-8(5)9(12)13/h1-4,11H,(H,12,13) |
| InChIKey | GUOODICBLRMEHR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |