C14H16BrNO4S2 — CID 90762756
bromomethane;3-[(2,3-dimethylphenyl)sulfonylamino]thiophene-2-carboxylic acid (PubChem CID 90762756) has the molecular formula C14H16BrNO4S2 and a molecular weight of 406.32 g/mol. Its IUPAC name is bromomethane;3-[(2,3-dimethylphenyl)sulfonylamino]thiophene-2-carboxylic acid.
| Compound Name | bromomethane;3-[(2,3-dimethylphenyl)sulfonylamino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 90762756 |
| Molecular Formula | C14H16BrNO4S2 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 404.97 |
| IUPAC Name | bromomethane;3-[(2,3-dimethylphenyl)sulfonylamino]thiophene-2-carboxylic acid |
| SMILES | CBr.Cc1cccc(S(=O)(=O)Nc2ccsc2C(=O)O)c1C |
| InChI | InChI=1S/C13H13NO4S2.CH3Br/c1-8-4-3-5-11(9(8)2)20(17,18)14-10-6-7-19-12(10)13(15)16;1-2/h3-7,14H,1-2H3,(H,15,16);1H3 |
| InChIKey | WYQKNSCJLIEXBG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|