C14H11ClN2OS — CID 112527047
5-chloro-N-(2-methyl-1H-indol-3-yl)thiophene-2-carboxamide (PubChem CID 112527047) has the molecular formula C14H11ClN2OS and a molecular weight of 290.78 g/mol. Its IUPAC name is 5-chloro-N-(2-methyl-1H-indol-3-yl)thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-(2-methyl-1H-indol-3-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 112527047 |
| Molecular Formula | C14H11ClN2OS |
| Molecular Weight | 290.78 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 5-chloro-N-(2-methyl-1H-indol-3-yl)thiophene-2-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1NC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H11ClN2OS/c1-8-13(9-4-2-3-5-10(9)16-8)17-14(18)11-6-7-12(15)19-11/h2-7,16H,1H3,(H,17,18) |
| InChIKey | HHXZTUAZNPQHST-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.78 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |