C13H12ClNOS — CID 7750910
5-chloro-N-(2-ethylphenyl)thiophene-2-carboxamide (PubChem CID 7750910) has the molecular formula C13H12ClNOS and a molecular weight of 265.77 g/mol. Its IUPAC name is 5-chloro-N-(2-ethylphenyl)thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-(2-ethylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 7750910 |
| Molecular Formula | C13H12ClNOS |
| Molecular Weight | 265.77 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 5-chloro-N-(2-ethylphenyl)thiophene-2-carboxamide |
| SMILES | CCc1ccccc1NC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H12ClNOS/c1-2-9-5-3-4-6-10(9)15-13(16)11-7-8-12(14)17-11/h3-8H,2H2,1H3,(H,15,16) |
| InChIKey | RQJZTNLYINAIHR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.77 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |