C9H14ClN3O3S2 — CID 77038493
2-[(5-chlorothiophen-2-yl)sulfonylamino]-N'-hydroxy-3-methylbutanimidamide (PubChem CID 77038493) has the molecular formula C9H14ClN3O3S2 and a molecular weight of 311.82 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)sulfonylamino]-N'-hydroxy-3-methylbutanimidamide.
| Compound Name | 2-[(5-chlorothiophen-2-yl)sulfonylamino]-N'-hydroxy-3-methylbutanimidamide |
|---|---|
| PubChem CID | 77038493 |
| Molecular Formula | C9H14ClN3O3S2 |
| Molecular Weight | 311.82 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)sulfonylamino]-N'-hydroxy-3-methylbutanimidamide |
| SMILES | CC(C)C(NS(=O)(=O)c1ccc(Cl)s1)C(N)=NO |
| InChI | InChI=1S/C9H14ClN3O3S2/c1-5(2)8(9(11)12-14)13-18(15,16)7-4-3-6(10)17-7/h3-5,8,13-14H,1-2H3,(H2,11,12) |
| InChIKey | XRBADQMHOPYDNA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.82 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|