C12H17N3O3S — CID 107801066
2-(cyclopropylmethylsulfonylamino)-N'-hydroxy-6-methylbenzenecarboximidamide (PubChem CID 107801066) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-(cyclopropylmethylsulfonylamino)-N'-hydroxy-6-methylbenzenecarboximidamide.
| Compound Name | 2-(cyclopropylmethylsulfonylamino)-N'-hydroxy-6-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 107801066 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-(cyclopropylmethylsulfonylamino)-N'-hydroxy-6-methylbenzenecarboximidamide |
| SMILES | Cc1cccc(NS(=O)(=O)CC2CC2)c1/C(N)=N/O |
| InChI | InChI=1S/C12H17N3O3S/c1-8-3-2-4-10(11(8)12(13)14-16)15-19(17,18)7-9-5-6-9/h2-4,9,15-16H,5-7H2,1H3,(H2,13,14) |
| InChIKey | FSMRQKLEGSXIIH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|