C11H16N2O4S2 — CID 64987508
4-(cyclopropylmethylsulfonylamino)-3-methylbenzenesulfonamide (PubChem CID 64987508) has the molecular formula C11H16N2O4S2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 4-(cyclopropylmethylsulfonylamino)-3-methylbenzenesulfonamide.
| Compound Name | 4-(cyclopropylmethylsulfonylamino)-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 64987508 |
| Molecular Formula | C11H16N2O4S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 4-(cyclopropylmethylsulfonylamino)-3-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(N)(=O)=O)ccc1NS(=O)(=O)CC1CC1 |
| InChI | InChI=1S/C11H16N2O4S2/c1-8-6-10(19(12,16)17)4-5-11(8)13-18(14,15)7-9-2-3-9/h4-6,9,13H,2-3,7H2,1H3,(H2,12,16,17) |
| InChIKey | HCPVTOAOLHBYRL-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |