C14H20BrNO2S — CID 61454090
N-(2-bromo-4-methylphenyl)-1-cyclohexylmethanesulfonamide (PubChem CID 61454090) has the molecular formula C14H20BrNO2S and a molecular weight of 346.29 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-1-cyclohexylmethanesulfonamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-1-cyclohexylmethanesulfonamide |
|---|---|
| PubChem CID | 61454090 |
| Molecular Formula | C14H20BrNO2S |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-1-cyclohexylmethanesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)CC2CCCCC2)c(Br)c1 |
| InChI | InChI=1S/C14H20BrNO2S/c1-11-7-8-14(13(15)9-11)16-19(17,18)10-12-5-3-2-4-6-12/h7-9,12,16H,2-6,10H2,1H3 |
| InChIKey | IENNSEBQAGESIE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |