C13H17BrFNO2S — CID 65431066
N-(4-bromo-3-fluorophenyl)-1-cyclohexylmethanesulfonamide (PubChem CID 65431066) has the molecular formula C13H17BrFNO2S and a molecular weight of 350.25 g/mol. Its IUPAC name is N-(4-bromo-3-fluorophenyl)-1-cyclohexylmethanesulfonamide.
| Compound Name | N-(4-bromo-3-fluorophenyl)-1-cyclohexylmethanesulfonamide |
|---|---|
| PubChem CID | 65431066 |
| Molecular Formula | C13H17BrFNO2S |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | N-(4-bromo-3-fluorophenyl)-1-cyclohexylmethanesulfonamide |
| SMILES | O=S(=O)(CC1CCCCC1)Nc1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C13H17BrFNO2S/c14-12-7-6-11(8-13(12)15)16-19(17,18)9-10-4-2-1-3-5-10/h6-8,10,16H,1-5,9H2 |
| InChIKey | KAIKMCBUXRDCPN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |