C12H16BrFN2O2S — CID 104779838
N-(3-bromo-4-fluorophenyl)-1-piperidin-4-ylmethanesulfonamide (PubChem CID 104779838) has the molecular formula C12H16BrFN2O2S and a molecular weight of 351.24 g/mol. Its IUPAC name is N-(3-bromo-4-fluorophenyl)-1-piperidin-4-ylmethanesulfonamide.
| Compound Name | N-(3-bromo-4-fluorophenyl)-1-piperidin-4-ylmethanesulfonamide |
|---|---|
| PubChem CID | 104779838 |
| Molecular Formula | C12H16BrFN2O2S |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | N-(3-bromo-4-fluorophenyl)-1-piperidin-4-ylmethanesulfonamide |
| SMILES | O=S(=O)(CC1CCNCC1)Nc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C12H16BrFN2O2S/c13-11-7-10(1-2-12(11)14)16-19(17,18)8-9-3-5-15-6-4-9/h1-2,7,9,15-16H,3-6,8H2 |
| InChIKey | IAJDRYYRSOENIU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |