C12H16F3N3O2S — CID 82795263
1-piperidin-4-yl-N-[6-(trifluoromethyl)-3-pyridinyl]methanesulfonamide (PubChem CID 82795263) has the molecular formula C12H16F3N3O2S and a molecular weight of 323.34 g/mol. Its IUPAC name is 1-piperidin-4-yl-N-[6-(trifluoromethyl)-3-pyridinyl]methanesulfonamide.
| Compound Name | 1-piperidin-4-yl-N-[6-(trifluoromethyl)-3-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 82795263 |
| Molecular Formula | C12H16F3N3O2S |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 1-piperidin-4-yl-N-[6-(trifluoromethyl)-3-pyridinyl]methanesulfonamide |
| SMILES | O=S(=O)(CC1CCNCC1)Nc1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C12H16F3N3O2S/c13-12(14,15)11-2-1-10(7-17-11)18-21(19,20)8-9-3-5-16-6-4-9/h1-2,7,9,16,18H,3-6,8H2 |
| InChIKey | GSGQWEKIIWVAPR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |