About N-(3,5-dichloro-4-fluorophenyl)-1-piperidin-4-ylmethanesulfonamide
N-(3,5-dichloro-4-fluorophenyl)-1-piperidin-4-ylmethanesulfonamide (PubChem CID 107575670) has the molecular formula C12H15Cl2FN2O2S
and a molecular weight of 341.24 g/mol. Its IUPAC name is N-(3,5-dichloro-4-fluorophenyl)-1-piperidin-4-ylmethanesulfonamide.
Molecular Properties
| Compound Name | N-(3,5-dichloro-4-fluorophenyl)-1-piperidin-4-ylmethanesulfonamide |
| PubChem CID | 107575670 |
| Molecular Formula | C12H15Cl2FN2O2S |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | N-(3,5-dichloro-4-fluorophenyl)-1-piperidin-4-ylmethanesulfonamide |
| SMILES | O=S(=O)(CC1CCNCC1)Nc1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2FN2O2S/c13-10-5-9(6-11(14)12(10)15)17-20(18,19)7-8-1-3-16-4-2-8/h5-6,8,16-17H,1-4,7H2 |
| InChIKey | UNDPQOXYUXCCSG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze N-(3,5-dichloro-4-fluorophenyl)-1-piperidin-4-ylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dichloro-4-fluorophenyl)-1-piperidin-4-ylmethanesulfonamide?
The IUPAC name of N-(3,5-dichloro-4-fluorophenyl)-1-piperidin-4-ylmethanesulfonamide (CID 107575670) is N-(3,5-dichloro-4-fluorophenyl)-1-piperidin-4-ylmethanesulfonamide.
What is the SMILES notation for N-(3,5-dichloro-4-fluorophenyl)-1-piperidin-4-ylmethanesulfonamide?
The canonical SMILES for N-(3,5-dichloro-4-fluorophenyl)-1-piperidin-4-ylmethanesulfonamide is O=S(=O)(CC1CCNCC1)Nc1cc(Cl)c(F)c(Cl)c1.
What is the InChIKey of N-(3,5-dichloro-4-fluorophenyl)-1-piperidin-4-ylmethanesulfonamide?
The InChIKey is UNDPQOXYUXCCSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Cl2FN2O2S/c13-10-5-9(6-11(14)12(10)15)17-20(18,19)7-8-1-3-16-4-2-8/h5-6,8,16-17H,1-4,7H2.
What are the key properties of N-(3,5-dichloro-4-fluorophenyl)-1-piperidin-4-ylmethanesulfonamide?
N-(3,5-dichloro-4-fluorophenyl)-1-piperidin-4-ylmethanesulfonamide has a molecular weight of 341.24 g/mol, XLogP of 2.87, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dichloro-4-fluorophenyl)-1-piperidin-4-ylmethanesulfonamide is sourced from PubChem (CID 107575670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).