C12H15Cl2FN2O2S — CID 107575670
N-(3,5-dichloro-4-fluorophenyl)-1-piperidin-4-ylmethanesulfonamide (PubChem CID 107575670) has the molecular formula C12H15Cl2FN2O2S and a molecular weight of 341.24 g/mol. Its IUPAC name is N-(3,5-dichloro-4-fluorophenyl)-1-piperidin-4-ylmethanesulfonamide.
| Compound Name | N-(3,5-dichloro-4-fluorophenyl)-1-piperidin-4-ylmethanesulfonamide |
|---|---|
| PubChem CID | 107575670 |
| Molecular Formula | C12H15Cl2FN2O2S |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | N-(3,5-dichloro-4-fluorophenyl)-1-piperidin-4-ylmethanesulfonamide |
| SMILES | O=S(=O)(CC1CCNCC1)Nc1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2FN2O2S/c13-10-5-9(6-11(14)12(10)15)17-20(18,19)7-8-1-3-16-4-2-8/h5-6,8,16-17H,1-4,7H2 |
| InChIKey | UNDPQOXYUXCCSG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|