C14H20F2N2O2S — CID 62617015
N-[2-(3,5-difluorophenyl)ethyl]-1-piperidin-4-ylmethanesulfonamide (PubChem CID 62617015) has the molecular formula C14H20F2N2O2S and a molecular weight of 318.39 g/mol. Its IUPAC name is N-[2-(3,5-difluorophenyl)ethyl]-1-piperidin-4-ylmethanesulfonamide.
| Compound Name | N-[2-(3,5-difluorophenyl)ethyl]-1-piperidin-4-ylmethanesulfonamide |
|---|---|
| PubChem CID | 62617015 |
| Molecular Formula | C14H20F2N2O2S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-[2-(3,5-difluorophenyl)ethyl]-1-piperidin-4-ylmethanesulfonamide |
| SMILES | O=S(=O)(CC1CCNCC1)NCCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H20F2N2O2S/c15-13-7-12(8-14(16)9-13)3-6-18-21(19,20)10-11-1-4-17-5-2-11/h7-9,11,17-18H,1-6,10H2 |
| InChIKey | RNNLFYGECSAGSF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |