C11H16F2N2O2S — CID 62615783
3-amino-N-[2-(3,5-difluorophenyl)ethyl]propane-1-sulfonamide (PubChem CID 62615783) has the molecular formula C11H16F2N2O2S and a molecular weight of 278.32 g/mol. Its IUPAC name is 3-amino-N-[2-(3,5-difluorophenyl)ethyl]propane-1-sulfonamide.
| Compound Name | 3-amino-N-[2-(3,5-difluorophenyl)ethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 62615783 |
| Molecular Formula | C11H16F2N2O2S |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 3-amino-N-[2-(3,5-difluorophenyl)ethyl]propane-1-sulfonamide |
| SMILES | NCCCS(=O)(=O)NCCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H16F2N2O2S/c12-10-6-9(7-11(13)8-10)2-4-15-18(16,17)5-1-3-14/h6-8,15H,1-5,14H2 |
| InChIKey | CUNBRJSPHGKNPB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |