C11H14F3N3O2S — CID 154804913
2-methyl-N-[6-(trifluoromethyl)-3-pyridinyl]pyrrolidine-1-sulfonamide (PubChem CID 154804913) has the molecular formula C11H14F3N3O2S and a molecular weight of 309.31 g/mol. Its IUPAC name is 2-methyl-N-[6-(trifluoromethyl)-3-pyridinyl]pyrrolidine-1-sulfonamide.
| Compound Name | 2-methyl-N-[6-(trifluoromethyl)-3-pyridinyl]pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 154804913 |
| Molecular Formula | C11H14F3N3O2S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 2-methyl-N-[6-(trifluoromethyl)-3-pyridinyl]pyrrolidine-1-sulfonamide |
| SMILES | CC1CCCN1S(=O)(=O)Nc1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C11H14F3N3O2S/c1-8-3-2-6-17(8)20(18,19)16-9-4-5-10(15-7-9)11(12,13)14/h4-5,7-8,16H,2-3,6H2,1H3 |
| InChIKey | WFWBJSZIYAXIIJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |