C11H13FN2O2S2 — CID 64988037
2-(cyclopropylmethylsulfonylamino)-6-fluorobenzenecarbothioamide (PubChem CID 64988037) has the molecular formula C11H13FN2O2S2 and a molecular weight of 288.37 g/mol. Its IUPAC name is 2-(cyclopropylmethylsulfonylamino)-6-fluorobenzenecarbothioamide.
| Compound Name | 2-(cyclopropylmethylsulfonylamino)-6-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 64988037 |
| Molecular Formula | C11H13FN2O2S2 |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 2-(cyclopropylmethylsulfonylamino)-6-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1c(F)cccc1NS(=O)(=O)CC1CC1 |
| InChI | InChI=1S/C11H13FN2O2S2/c12-8-2-1-3-9(10(8)11(13)17)14-18(15,16)6-7-4-5-7/h1-3,7,14H,4-6H2,(H2,13,17) |
| InChIKey | VUTKPYLZMDSPOT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|