C12H16N2O3S2 — CID 104849504
4-(cyclopropylmethylsulfonylamino)-3-methoxybenzenecarbothioamide (PubChem CID 104849504) has the molecular formula C12H16N2O3S2 and a molecular weight of 300.41 g/mol. Its IUPAC name is 4-(cyclopropylmethylsulfonylamino)-3-methoxybenzenecarbothioamide.
| Compound Name | 4-(cyclopropylmethylsulfonylamino)-3-methoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 104849504 |
| Molecular Formula | C12H16N2O3S2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 4-(cyclopropylmethylsulfonylamino)-3-methoxybenzenecarbothioamide |
| SMILES | COc1cc(C(N)=S)ccc1NS(=O)(=O)CC1CC1 |
| InChI | InChI=1S/C12H16N2O3S2/c1-17-11-6-9(12(13)18)4-5-10(11)14-19(15,16)7-8-2-3-8/h4-6,8,14H,2-3,7H2,1H3,(H2,13,18) |
| InChIKey | CDWGIJALNADXAB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|