C11H16N2O5S2 — CID 64987778
5-(cyclopropylmethylsulfonylamino)-2-methoxybenzenesulfonamide (PubChem CID 64987778) has the molecular formula C11H16N2O5S2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 5-(cyclopropylmethylsulfonylamino)-2-methoxybenzenesulfonamide.
| Compound Name | 5-(cyclopropylmethylsulfonylamino)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 64987778 |
| Molecular Formula | C11H16N2O5S2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 5-(cyclopropylmethylsulfonylamino)-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)CC2CC2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C11H16N2O5S2/c1-18-10-5-4-9(6-11(10)20(12,16)17)13-19(14,15)7-8-2-3-8/h4-6,8,13H,2-3,7H2,1H3,(H2,12,16,17) |
| InChIKey | FXNMZQBVGCPTDO-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |