C12H17N3O4S — CID 116658847
1-cyclobutyl-3-(4-methoxy-3-sulfamoylphenyl)urea (PubChem CID 116658847) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is 1-cyclobutyl-3-(4-methoxy-3-sulfamoylphenyl)urea.
| Compound Name | 1-cyclobutyl-3-(4-methoxy-3-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 116658847 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 1-cyclobutyl-3-(4-methoxy-3-sulfamoylphenyl)urea |
| SMILES | COc1ccc(NC(=O)NC2CCC2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C12H17N3O4S/c1-19-10-6-5-9(7-11(10)20(13,17)18)15-12(16)14-8-3-2-4-8/h5-8H,2-4H2,1H3,(H2,13,17,18)(H2,14,15,16) |
| InChIKey | BEAWPHVGEZOQPZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |