C12H11N3O2S — CID 114002396
1-cyclopropyl-N-(3,4-dicyanophenyl)methanesulfonamide (PubChem CID 114002396) has the molecular formula C12H11N3O2S and a molecular weight of 261.31 g/mol. Its IUPAC name is 1-cyclopropyl-N-(3,4-dicyanophenyl)methanesulfonamide.
| Compound Name | 1-cyclopropyl-N-(3,4-dicyanophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 114002396 |
| Molecular Formula | C12H11N3O2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 1-cyclopropyl-N-(3,4-dicyanophenyl)methanesulfonamide |
| SMILES | N#Cc1ccc(NS(=O)(=O)CC2CC2)cc1C#N |
| InChI | InChI=1S/C12H11N3O2S/c13-6-10-3-4-12(5-11(10)7-14)15-18(16,17)8-9-1-2-9/h3-5,9,15H,1-2,8H2 |
| InChIKey | BCMGSBAMVISSRX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |