C11H16N2O3S2 — CID 104849487
3-methoxy-4-(propan-2-ylsulfonylamino)benzenecarbothioamide (PubChem CID 104849487) has the molecular formula C11H16N2O3S2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-methoxy-4-(propan-2-ylsulfonylamino)benzenecarbothioamide.
| Compound Name | 3-methoxy-4-(propan-2-ylsulfonylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 104849487 |
| Molecular Formula | C11H16N2O3S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 3-methoxy-4-(propan-2-ylsulfonylamino)benzenecarbothioamide |
| SMILES | COc1cc(C(N)=S)ccc1NS(=O)(=O)C(C)C |
| InChI | InChI=1S/C11H16N2O3S2/c1-7(2)18(14,15)13-9-5-4-8(11(12)17)6-10(9)16-3/h4-7,13H,1-3H3,(H2,12,17) |
| InChIKey | PHGJMHLWQDRLNK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|