C15H19FN2S — CID 79520182
2-(2,2-dicyclopropylethylamino)-6-fluorobenzenecarbothioamide (PubChem CID 79520182) has the molecular formula C15H19FN2S and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-(2,2-dicyclopropylethylamino)-6-fluorobenzenecarbothioamide.
| Compound Name | 2-(2,2-dicyclopropylethylamino)-6-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 79520182 |
| Molecular Formula | C15H19FN2S |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-(2,2-dicyclopropylethylamino)-6-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1c(F)cccc1NCC(C1CC1)C1CC1 |
| InChI | InChI=1S/C15H19FN2S/c16-12-2-1-3-13(14(12)15(17)19)18-8-11(9-4-5-9)10-6-7-10/h1-3,9-11,18H,4-8H2,(H2,17,19) |
| InChIKey | SZYWLDGICODTQW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|