C14H15FN2S2 — CID 106010326
2-[(5-ethylthiophen-2-yl)methylamino]-6-fluorobenzenecarbothioamide (PubChem CID 106010326) has the molecular formula C14H15FN2S2 and a molecular weight of 294.42 g/mol. Its IUPAC name is 2-[(5-ethylthiophen-2-yl)methylamino]-6-fluorobenzenecarbothioamide.
| Compound Name | 2-[(5-ethylthiophen-2-yl)methylamino]-6-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 106010326 |
| Molecular Formula | C14H15FN2S2 |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-[(5-ethylthiophen-2-yl)methylamino]-6-fluorobenzenecarbothioamide |
| SMILES | CCc1ccc(CNc2cccc(F)c2C(N)=S)s1 |
| InChI | InChI=1S/C14H15FN2S2/c1-2-9-6-7-10(19-9)8-17-12-5-3-4-11(15)13(12)14(16)18/h3-7,17H,2,8H2,1H3,(H2,16,18) |
| InChIKey | UKJBPBRYTXHBHO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|