C12H17FN2S — CID 79513321
2-fluoro-6-(pentylamino)benzenecarbothioamide (PubChem CID 79513321) has the molecular formula C12H17FN2S and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-fluoro-6-(pentylamino)benzenecarbothioamide.
| Compound Name | 2-fluoro-6-(pentylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 79513321 |
| Molecular Formula | C12H17FN2S |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 2-fluoro-6-(pentylamino)benzenecarbothioamide |
| SMILES | CCCCCNc1cccc(F)c1C(N)=S |
| InChI | InChI=1S/C12H17FN2S/c1-2-3-4-8-15-10-7-5-6-9(13)11(10)12(14)16/h5-7,15H,2-4,8H2,1H3,(H2,14,16) |
| InChIKey | MLBCPYCMRHKGFT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|