C13H18F2N2S — CID 114017841
2,3-difluoro-4-(hexylamino)benzenecarbothioamide (PubChem CID 114017841) has the molecular formula C13H18F2N2S and a molecular weight of 272.36 g/mol. Its IUPAC name is 2,3-difluoro-4-(hexylamino)benzenecarbothioamide.
| Compound Name | 2,3-difluoro-4-(hexylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 114017841 |
| Molecular Formula | C13H18F2N2S |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2,3-difluoro-4-(hexylamino)benzenecarbothioamide |
| SMILES | CCCCCCNc1ccc(C(N)=S)c(F)c1F |
| InChI | InChI=1S/C13H18F2N2S/c1-2-3-4-5-8-17-10-7-6-9(13(16)18)11(14)12(10)15/h6-7,17H,2-5,8H2,1H3,(H2,16,18) |
| InChIKey | BBEPZFVOXOXPLF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|