C11H12F2N2O2S — CID 114017826
methyl 3-(4-carbamothioyl-2,3-difluoroanilino)propanoate (PubChem CID 114017826) has the molecular formula C11H12F2N2O2S and a molecular weight of 274.29 g/mol. Its IUPAC name is methyl 3-(4-carbamothioyl-2,3-difluoroanilino)propanoate.
| Compound Name | methyl 3-(4-carbamothioyl-2,3-difluoroanilino)propanoate |
|---|---|
| PubChem CID | 114017826 |
| Molecular Formula | C11H12F2N2O2S |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | methyl 3-(4-carbamothioyl-2,3-difluoroanilino)propanoate |
| SMILES | COC(=O)CCNc1ccc(C(N)=S)c(F)c1F |
| InChI | InChI=1S/C11H12F2N2O2S/c1-17-8(16)4-5-15-7-3-2-6(11(14)18)9(12)10(7)13/h2-3,15H,4-5H2,1H3,(H2,14,18) |
| InChIKey | OYYYRJVIRZSSND-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|