C12H16ClN3O3 — CID 77050359
2-methylpropyl N-[5-chloro-2-(N'-hydroxycarbamimidoyl)phenyl]carbamate (PubChem CID 77050359) has the molecular formula C12H16ClN3O3 and a molecular weight of 285.73 g/mol. Its IUPAC name is 2-methylpropyl N-[5-chloro-2-(N'-hydroxycarbamimidoyl)phenyl]carbamate.
| Compound Name | 2-methylpropyl N-[5-chloro-2-(N'-hydroxycarbamimidoyl)phenyl]carbamate |
|---|---|
| PubChem CID | 77050359 |
| Molecular Formula | C12H16ClN3O3 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 2-methylpropyl N-[5-chloro-2-(N'-hydroxycarbamimidoyl)phenyl]carbamate |
| SMILES | CC(C)COC(=O)Nc1cc(Cl)ccc1C(N)=NO |
| InChI | InChI=1S/C12H16ClN3O3/c1-7(2)6-19-12(17)15-10-5-8(13)3-4-9(10)11(14)16-18/h3-5,7,18H,6H2,1-2H3,(H2,14,16)(H,15,17) |
| InChIKey | OCVMVZPIBNXANE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|