C7H7ClF2N2O2S — CID 28606569
N-(2-amino-4-chlorophenyl)-1,1-difluoromethanesulfonamide (PubChem CID 28606569) has the molecular formula C7H7ClF2N2O2S and a molecular weight of 256.66 g/mol. Its IUPAC name is N-(2-amino-4-chlorophenyl)-1,1-difluoromethanesulfonamide.
| Compound Name | N-(2-amino-4-chlorophenyl)-1,1-difluoromethanesulfonamide |
|---|---|
| PubChem CID | 28606569 |
| Molecular Formula | C7H7ClF2N2O2S |
| Molecular Weight | 256.66 g/mol |
| Exact Mass | 255.99 |
| IUPAC Name | N-(2-amino-4-chlorophenyl)-1,1-difluoromethanesulfonamide |
| SMILES | Nc1cc(Cl)ccc1NS(=O)(=O)C(F)F |
| InChI | InChI=1S/C7H7ClF2N2O2S/c8-4-1-2-6(5(11)3-4)12-15(13,14)7(9)10/h1-3,7,12H,11H2 |
| InChIKey | QCIQZJHLIAISOX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.66 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|