C6H6ClFN2 — CID 146389148
4-chloro-1-N-fluorobenzene-1,2-diamine (PubChem CID 146389148) has the molecular formula C6H6ClFN2 and a molecular weight of 160.58 g/mol. Its IUPAC name is 4-chloro-1-N-fluorobenzene-1,2-diamine.
| Compound Name | 4-chloro-1-N-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 146389148 |
| Molecular Formula | C6H6ClFN2 |
| Molecular Weight | 160.58 g/mol |
| Exact Mass | 160.02 |
| IUPAC Name | 4-chloro-1-N-fluorobenzene-1,2-diamine |
| SMILES | Nc1cc(Cl)ccc1NF |
| InChI | InChI=1S/C6H6ClFN2/c7-4-1-2-6(10-8)5(9)3-4/h1-3,10H,9H2 |
| InChIKey | HSRHIAQERJWLIR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.58 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|