C11H16N4O5S — CID 114465982
ethyl N-[[2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-methylsulfamoyl]carbamate (PubChem CID 114465982) has the molecular formula C11H16N4O5S and a molecular weight of 316.34 g/mol. Its IUPAC name is ethyl N-[[2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-methylsulfamoyl]carbamate.
| Compound Name | ethyl N-[[2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-methylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 114465982 |
| Molecular Formula | C11H16N4O5S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | ethyl N-[[2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-methylsulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)N(C)c1ccccc1/C(N)=N/O |
| InChI | InChI=1S/C11H16N4O5S/c1-3-20-11(16)14-21(18,19)15(2)9-7-5-4-6-8(9)10(12)13-17/h4-7,17H,3H2,1-2H3,(H2,12,13)(H,14,16) |
| InChIKey | XDHNRPACJLQELD-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 134.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|