C10H14N4O5S — CID 114465981
methyl N-[[2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-methylsulfamoyl]carbamate (PubChem CID 114465981) has the molecular formula C10H14N4O5S and a molecular weight of 302.31 g/mol. Its IUPAC name is methyl N-[[2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-methylsulfamoyl]carbamate.
| Compound Name | methyl N-[[2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-methylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 114465981 |
| Molecular Formula | C10H14N4O5S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | methyl N-[[2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-methylsulfamoyl]carbamate |
| SMILES | COC(=O)NS(=O)(=O)N(C)c1ccccc1/C(N)=N/O |
| InChI | InChI=1S/C10H14N4O5S/c1-14(20(17,18)13-10(15)19-2)8-6-4-3-5-7(8)9(11)12-16/h3-6,16H,1-2H3,(H2,11,12)(H,13,15) |
| InChIKey | WUCDYMNJPQMTDX-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 134.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|