C10H14N4O4S — CID 114467313
methyl N-[(3-carbamimidoylphenyl)-methylsulfamoyl]carbamate (PubChem CID 114467313) has the molecular formula C10H14N4O4S and a molecular weight of 286.31 g/mol. Its IUPAC name is methyl N-[(3-carbamimidoylphenyl)-methylsulfamoyl]carbamate.
| Compound Name | methyl N-[(3-carbamimidoylphenyl)-methylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 114467313 |
| Molecular Formula | C10H14N4O4S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | methyl N-[(3-carbamimidoylphenyl)-methylsulfamoyl]carbamate |
| SMILES | [H]/N=C(\N)c1cccc(N(C)S(=O)(=O)NC(=O)OC)c1 |
| InChI | InChI=1S/C10H14N4O4S/c1-14(19(16,17)13-10(15)18-2)8-5-3-4-7(6-8)9(11)12/h3-6H,1-2H3,(H3,11,12)(H,13,15) |
| InChIKey | JZRAGUJYYUIEGF-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 125.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|