C13H16N6O2 — CID 62971388
3-[(4,6-dimethoxy-1,3,5-triazin-2-yl)-methylamino]benzenecarboximidamide (PubChem CID 62971388) has the molecular formula C13H16N6O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is 3-[(4,6-dimethoxy-1,3,5-triazin-2-yl)-methylamino]benzenecarboximidamide.
| Compound Name | 3-[(4,6-dimethoxy-1,3,5-triazin-2-yl)-methylamino]benzenecarboximidamide |
|---|---|
| PubChem CID | 62971388 |
| Molecular Formula | C13H16N6O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 3-[(4,6-dimethoxy-1,3,5-triazin-2-yl)-methylamino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(N(C)c2nc(OC)nc(OC)n2)c1 |
| InChI | InChI=1S/C13H16N6O2/c1-19(9-6-4-5-8(7-9)10(14)15)11-16-12(20-2)18-13(17-11)21-3/h4-7H,1-3H3,(H3,14,15) |
| InChIKey | VTHMCBAXLKXKBF-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|