About 3-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(methyl)amino]benzenecarboximidamide
3-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(methyl)amino]benzenecarboximidamide (PubChem CID 62971559) has the molecular formula C15H17N5
and a molecular weight of 267.34 g/mol. Its IUPAC name is 3-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(methyl)amino]benzenecarboximidamide.
Molecular Properties
| Compound Name | 3-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(methyl)amino]benzenecarboximidamide |
| PubChem CID | 62971559 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 3-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(methyl)amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(N(C)c2ncnc3c2CCC3)c1 |
| InChI | InChI=1S/C15H17N5/c1-20(11-5-2-4-10(8-11)14(16)17)15-12-6-3-7-13(12)18-9-19-15/h2,4-5,8-9H,3,6-7H2,1H3,(H3,16,17) |
| InChIKey | ZKKICELVZFOKAH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(methyl)amino]benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(methyl)amino]benzenecarboximidamide?
The IUPAC name of 3-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(methyl)amino]benzenecarboximidamide (CID 62971559) is 3-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(methyl)amino]benzenecarboximidamide.
What is the SMILES notation for 3-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(methyl)amino]benzenecarboximidamide?
The canonical SMILES for 3-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(methyl)amino]benzenecarboximidamide is [H]/N=C(\N)c1cccc(N(C)c2ncnc3c2CCC3)c1.
What is the InChIKey of 3-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(methyl)amino]benzenecarboximidamide?
The InChIKey is ZKKICELVZFOKAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N5/c1-20(11-5-2-4-10(8-11)14(16)17)15-12-6-3-7-13(12)18-9-19-15/h2,4-5,8-9H,3,6-7H2,1H3,(H3,16,17).
What are the key properties of 3-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(methyl)amino]benzenecarboximidamide?
3-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(methyl)amino]benzenecarboximidamide has a molecular weight of 267.34 g/mol, XLogP of 2.02, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(methyl)amino]benzenecarboximidamide is sourced from PubChem (CID 62971559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).