C15H17N5 — CID 62970161
4-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(methyl)amino]benzenecarboximidamide (PubChem CID 62970161) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is 4-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(methyl)amino]benzenecarboximidamide.
| Compound Name | 4-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(methyl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 62970161 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 4-[6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl(methyl)amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N(C)c2ncnc3c2CCC3)cc1 |
| InChI | InChI=1S/C15H17N5/c1-20(11-7-5-10(6-8-11)14(16)17)15-12-3-2-4-13(12)18-9-19-15/h5-9H,2-4H2,1H3,(H3,16,17) |
| InChIKey | MPQAVGLTHGZJQV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|