C12H12ClN5O — CID 136971709
4-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)-methylamino]benzenecarboximidamide (PubChem CID 136971709) has the molecular formula C12H12ClN5O and a molecular weight of 277.72 g/mol. Its IUPAC name is 4-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)-methylamino]benzenecarboximidamide.
| Compound Name | 4-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)-methylamino]benzenecarboximidamide |
|---|---|
| PubChem CID | 136971709 |
| Molecular Formula | C12H12ClN5O |
| Molecular Weight | 277.72 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 4-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)-methylamino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N(C)c2nc[nH]c(=O)c2Cl)cc1 |
| InChI | InChI=1S/C12H12ClN5O/c1-18(11-9(13)12(19)17-6-16-11)8-4-2-7(3-5-8)10(14)15/h2-6H,1H3,(H3,14,15)(H,16,17,19) |
| InChIKey | WKWULFUAGABJKG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.72 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|