C19H14Cl2N8 — CID 19850685
4-[[4-[(4,6-dichloro-5-cyanopyrimidin-2-yl)-methylamino]phenyl]diazenyl]benzenecarboximidamide (PubChem CID 19850685) has the molecular formula C19H14Cl2N8 and a molecular weight of 425.28 g/mol. Its IUPAC name is 4-[[4-[(4,6-dichloro-5-cyanopyrimidin-2-yl)-methylamino]phenyl]diazenyl]benzenecarboximidamide.
| Compound Name | 4-[[4-[(4,6-dichloro-5-cyanopyrimidin-2-yl)-methylamino]phenyl]diazenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 19850685 |
| Molecular Formula | C19H14Cl2N8 |
| Molecular Weight | 425.28 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 4-[[4-[(4,6-dichloro-5-cyanopyrimidin-2-yl)-methylamino]phenyl]diazenyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(/N=N/c2ccc(N(C)c3nc(Cl)c(C#N)c(Cl)n3)cc2)cc1 |
| InChI | InChI=1S/C19H14Cl2N8/c1-29(19-25-16(20)15(10-22)17(21)26-19)14-8-6-13(7-9-14)28-27-12-4-2-11(3-5-12)18(23)24/h2-9H,1H3,(H3,23,24)/b28-27+ |
| InChIKey | RHAQKXUDGJCENJ-BYYHNAKLSA-N |
| XLogP | 5.12 |
| TPSA | 127.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.28 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|