C12H20ClN5 — CID 6431834
4-[[methyl(2-methylpropyl)amino]diazenyl]benzenecarboximidamide;hydrochloride (PubChem CID 6431834) has the molecular formula C12H20ClN5 and a molecular weight of 269.78 g/mol. Its IUPAC name is 4-[[methyl(2-methylpropyl)amino]diazenyl]benzenecarboximidamide;hydrochloride.
| Compound Name | 4-[[methyl(2-methylpropyl)amino]diazenyl]benzenecarboximidamide;hydrochloride |
|---|---|
| PubChem CID | 6431834 |
| Molecular Formula | C12H20ClN5 |
| Molecular Weight | 269.78 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 4-[[methyl(2-methylpropyl)amino]diazenyl]benzenecarboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(/N=N/N(C)CC(C)C)cc1 |
| InChI | InChI=1S/C12H19N5.ClH/c1-9(2)8-17(3)16-15-11-6-4-10(5-7-11)12(13)14;/h4-7,9H,8H2,1-3H3,(H3,13,14);1H/b16-15+; |
| InChIKey | GDJFSGMXUXDKEW-GEEYTBSJSA-N |
| XLogP | 2.98 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.78 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|