C17H21N7O — CID 10088567
4-[[4-carbamimidoyl-N-(3-hydroxypropyl)anilino]diazenyl]benzenecarboximidamide (PubChem CID 10088567) has the molecular formula C17H21N7O and a molecular weight of 339.40 g/mol. Its IUPAC name is 4-[[4-carbamimidoyl-N-(3-hydroxypropyl)anilino]diazenyl]benzenecarboximidamide.
| Compound Name | 4-[[4-carbamimidoyl-N-(3-hydroxypropyl)anilino]diazenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 10088567 |
| Molecular Formula | C17H21N7O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 4-[[4-carbamimidoyl-N-(3-hydroxypropyl)anilino]diazenyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(/N=N/N(CCCO)c2ccc(/C(N)=N/[H])cc2)cc1 |
| InChI | InChI=1S/C17H21N7O/c18-16(19)12-2-6-14(7-3-12)22-23-24(10-1-11-25)15-8-4-13(5-9-15)17(20)21/h2-9,25H,1,10-11H2,(H3,18,19)(H3,20,21)/b23-22+ |
| InChIKey | BMKBLIGHAJSQNA-GHVJWSGMSA-N |
| XLogP | 2.14 |
| TPSA | 147.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|