C14H16N4 — CID 113482500
4-[methyl-(2-methyl-4-pyridinyl)amino]benzenecarboximidamide (PubChem CID 113482500) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is 4-[methyl-(2-methyl-4-pyridinyl)amino]benzenecarboximidamide.
| Compound Name | 4-[methyl-(2-methyl-4-pyridinyl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 113482500 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 4-[methyl-(2-methyl-4-pyridinyl)amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N(C)c2ccnc(C)c2)cc1 |
| InChI | InChI=1S/C14H16N4/c1-10-9-13(7-8-17-10)18(2)12-5-3-11(4-6-12)14(15)16/h3-9H,1-2H3,(H3,15,16) |
| InChIKey | YFFNSENJMCODKO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|