C14H12F3N3 — CID 81293537
3,5-difluoro-4-(3-fluoro-N-methylanilino)benzenecarboximidamide (PubChem CID 81293537) has the molecular formula C14H12F3N3 and a molecular weight of 279.27 g/mol. Its IUPAC name is 3,5-difluoro-4-(3-fluoro-N-methylanilino)benzenecarboximidamide.
| Compound Name | 3,5-difluoro-4-(3-fluoro-N-methylanilino)benzenecarboximidamide |
|---|---|
| PubChem CID | 81293537 |
| Molecular Formula | C14H12F3N3 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 3,5-difluoro-4-(3-fluoro-N-methylanilino)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)c(N(C)c2cccc(F)c2)c(F)c1 |
| InChI | InChI=1S/C14H12F3N3/c1-20(10-4-2-3-9(15)7-10)13-11(16)5-8(14(18)19)6-12(13)17/h2-7H,1H3,(H3,18,19) |
| InChIKey | ZPWUIGBTOCMRQJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|