C13H16FN5 — CID 63752734
5-(3-fluoro-N-methylanilino)-1,3-dimethylpyrazole-4-carboximidamide (PubChem CID 63752734) has the molecular formula C13H16FN5 and a molecular weight of 261.30 g/mol. Its IUPAC name is 5-(3-fluoro-N-methylanilino)-1,3-dimethylpyrazole-4-carboximidamide.
| Compound Name | 5-(3-fluoro-N-methylanilino)-1,3-dimethylpyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 63752734 |
| Molecular Formula | C13H16FN5 |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 5-(3-fluoro-N-methylanilino)-1,3-dimethylpyrazole-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)nn(C)c1N(C)c1cccc(F)c1 |
| InChI | InChI=1S/C13H16FN5/c1-8-11(12(15)16)13(19(3)17-8)18(2)10-6-4-5-9(14)7-10/h4-7H,1-3H3,(H3,15,16) |
| InChIKey | JZDKATNWTJRSBI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|