About 5-(6-fluoro-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazole-4-carboximidamide
5-(6-fluoro-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazole-4-carboximidamide (PubChem CID 103496179) has the molecular formula C14H16FN5
and a molecular weight of 273.31 g/mol. Its IUPAC name is 5-(6-fluoro-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazole-4-carboximidamide.
Molecular Properties
| Compound Name | 5-(6-fluoro-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazole-4-carboximidamide |
| PubChem CID | 103496179 |
| Molecular Formula | C14H16FN5 |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 5-(6-fluoro-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazole-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)nn(C)c1N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C14H16FN5/c1-8-12(13(16)17)14(19(2)18-8)20-6-5-9-3-4-10(15)7-11(9)20/h3-4,7H,5-6H2,1-2H3,(H3,16,17) |
| InChIKey | MXBHLNGGWUTYKQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(6-fluoro-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazole-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6-fluoro-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazole-4-carboximidamide?
The IUPAC name of 5-(6-fluoro-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazole-4-carboximidamide (CID 103496179) is 5-(6-fluoro-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazole-4-carboximidamide.
What is the SMILES notation for 5-(6-fluoro-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazole-4-carboximidamide?
The canonical SMILES for 5-(6-fluoro-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazole-4-carboximidamide is [H]/N=C(\N)c1c(C)nn(C)c1N1CCc2ccc(F)cc21.
What is the InChIKey of 5-(6-fluoro-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazole-4-carboximidamide?
The InChIKey is MXBHLNGGWUTYKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16FN5/c1-8-12(13(16)17)14(19(2)18-8)20-6-5-9-3-4-10(15)7-11(9)20/h3-4,7H,5-6H2,1-2H3,(H3,16,17).
What are the key properties of 5-(6-fluoro-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazole-4-carboximidamide?
5-(6-fluoro-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazole-4-carboximidamide has a molecular weight of 273.31 g/mol, XLogP of 1.85, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6-fluoro-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazole-4-carboximidamide is sourced from PubChem (CID 103496179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).