C14H16FN5 — CID 103496179
5-(6-fluoro-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazole-4-carboximidamide (PubChem CID 103496179) has the molecular formula C14H16FN5 and a molecular weight of 273.31 g/mol. Its IUPAC name is 5-(6-fluoro-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazole-4-carboximidamide.
| Compound Name | 5-(6-fluoro-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 103496179 |
| Molecular Formula | C14H16FN5 |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 5-(6-fluoro-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazole-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)nn(C)c1N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C14H16FN5/c1-8-12(13(16)17)14(19(2)18-8)20-6-5-9-3-4-10(15)7-11(9)20/h3-4,7H,5-6H2,1-2H3,(H3,16,17) |
| InChIKey | MXBHLNGGWUTYKQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|