C13H22N6 — CID 55243294
5-(4-cyclopropylpiperazin-1-yl)-1,3-dimethylpyrazole-4-carboximidamide (PubChem CID 55243294) has the molecular formula C13H22N6 and a molecular weight of 262.36 g/mol. Its IUPAC name is 5-(4-cyclopropylpiperazin-1-yl)-1,3-dimethylpyrazole-4-carboximidamide.
| Compound Name | 5-(4-cyclopropylpiperazin-1-yl)-1,3-dimethylpyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 55243294 |
| Molecular Formula | C13H22N6 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 5-(4-cyclopropylpiperazin-1-yl)-1,3-dimethylpyrazole-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)nn(C)c1N1CCN(C2CC2)CC1 |
| InChI | InChI=1S/C13H22N6/c1-9-11(12(14)15)13(17(2)16-9)19-7-5-18(6-8-19)10-3-4-10/h10H,3-8H2,1-2H3,(H3,14,15) |
| InChIKey | FAEMHBRQZYFBLE-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|