C15H18N4S — CID 63757894
5-(3,4-dihydro-2H-quinolin-1-yl)-1,3-dimethylpyrazole-4-carbothioamide (PubChem CID 63757894) has the molecular formula C15H18N4S and a molecular weight of 286.40 g/mol. Its IUPAC name is 5-(3,4-dihydro-2H-quinolin-1-yl)-1,3-dimethylpyrazole-4-carbothioamide.
| Compound Name | 5-(3,4-dihydro-2H-quinolin-1-yl)-1,3-dimethylpyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 63757894 |
| Molecular Formula | C15H18N4S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 5-(3,4-dihydro-2H-quinolin-1-yl)-1,3-dimethylpyrazole-4-carbothioamide |
| SMILES | Cc1nn(C)c(N2CCCc3ccccc32)c1C(N)=S |
| InChI | InChI=1S/C15H18N4S/c1-10-13(14(16)20)15(18(2)17-10)19-9-5-7-11-6-3-4-8-12(11)19/h3-4,6,8H,5,7,9H2,1-2H3,(H2,16,20) |
| InChIKey | LMFMBZIJNWCGPY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|