C12H14FN3 — CID 89228433
(2Z)-4-(3-fluoro-N-methylanilino)penta-2,4-dienimidamide (PubChem CID 89228433) has the molecular formula C12H14FN3 and a molecular weight of 219.26 g/mol. Its IUPAC name is (2Z)-4-(3-fluoro-N-methylanilino)penta-2,4-dienimidamide.
| Compound Name | (2Z)-4-(3-fluoro-N-methylanilino)penta-2,4-dienimidamide |
|---|---|
| PubChem CID | 89228433 |
| Molecular Formula | C12H14FN3 |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | (2Z)-4-(3-fluoro-N-methylanilino)penta-2,4-dienimidamide |
| SMILES | [H]/N=C(N)/C=C\C(=C)N(C)c1cccc(F)c1 |
| InChI | InChI=1S/C12H14FN3/c1-9(6-7-12(14)15)16(2)11-5-3-4-10(13)8-11/h3-8H,1H2,2H3,(H3,14,15)/b7-6- |
| InChIKey | OQNKSQOJVKORRB-SREVYHEPSA-N |
| XLogP | 2.27 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|