C11H15FN2O — CID 116655437
1-ethyl-3-(3-fluorophenyl)-1,3-dimethylurea (PubChem CID 116655437) has the molecular formula C11H15FN2O and a molecular weight of 210.25 g/mol. Its IUPAC name is 1-ethyl-3-(3-fluorophenyl)-1,3-dimethylurea.
| Compound Name | 1-ethyl-3-(3-fluorophenyl)-1,3-dimethylurea |
|---|---|
| PubChem CID | 116655437 |
| Molecular Formula | C11H15FN2O |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 1-ethyl-3-(3-fluorophenyl)-1,3-dimethylurea |
| SMILES | CCN(C)C(=O)N(C)c1cccc(F)c1 |
| InChI | InChI=1S/C11H15FN2O/c1-4-13(2)11(15)14(3)10-7-5-6-9(12)8-10/h5-8H,4H2,1-3H3 |
| InChIKey | BGHDWPBRLREXOA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |